| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]- |
| Synonyms: | 2-(4-Isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)nicotinic acid;Charper;Chopper;Imazapyr;94795-74-1; |
| CAS: | 81334-34-1 |
| Molecular Formula: | C13H15N3O3 |
| Molecular Weight: | 261.28 |
| InChI: | InChI=1/C13H15N3O3/c1-7(2)13(3)12(19)15-10(16-13)9-8(11(17)18)5-4-6-14-9/h4-7H,1-3H3,(H,17,18)(H,15,16,19) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.34 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.61 |
| Solubility: | Very soluble |
| Appearance: | Off-white crystal |
| Specification: |
3-Pyridinecarboxylicacid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]- , its cas register number is 81334-34-1. It also can be called (+-)-Imazapyr ; 2-(4,5-Dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl)-3-pyridinecarboxylic acid ; 2-(4-Isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)nicotinic acid ; AC 243,997 ; Arsenal ; Arsenal 250A ; Chopper ; EPA Pesticide Chemical Code 128821 ; HSDB 6676 ; Imazapyr . 3-Pyridinecarboxylicacid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]- (CAS NO.81334-34-1) is harmful to aquatic organisms, and may cause long-term adverse effects in the aquatic environment. |
| Storage Temperature: | 0-6°C |
| Color: | Clear, slightly viscous, pale yellow to dark green aqueous liquid White to tan powder Crystals from acetone + hexane |
| Usage: | Substance is used as a herbicide. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
