| Identification | |
| Name: | N-Cyclopropyl-N'-(2,5-difluorophenyl)urea |
| Synonyms: | urea, N-cyclopropyl-N'-(2,5-difluorophenyl)- |
| CAS: | 81356-60-7 |
| Molecular Formula: | C10H10F2N2O |
| Molecular Weight: | 212.196 |
| InChI: | InChI=1/C10H10F2N2O/c11-6-1-4-8(12)9(5-6)14-10(15)13-7-2-3-7/h1,4-5,7H,2-3H2,(H2,13,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 114.6°C |
| Boiling Point: | 265.9°C at 760 mmHg |
| Density: | 1.32g/cm3 |
| Refractive index: | 1.549 |
| Specification: |
N-Cyclopropyl-N'-(2,5-difluorophenyl)urea , its cas register number is 81356-60-7. It also can be called SD 91779 ; Urea, N-cyclopropyl-N'-(2,5-difluorophenyl)- . It is moderate toxic by skin contact. And N-Cyclopropyl-N'-(2,5-difluorophenyl)urea (CAS NO.81356-60-7) will cause a mild skin and eye irritant. When heated to decomposition it emits toxic vapors of NOx and F− |
| Flash Point: | 114.6°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
