| Identification | |
| Name: | 1,2-Propanedithiol |
| Synonyms: | 1,2-Dimercaptopropane;1,2-Dithiolpropane; 1-Methyl-1,2-ethanedithiol; 2,3-Dimercaptopropane; NSC72085 |
| CAS: | 814-67-5 |
| EINECS: | 212-398-5 |
| Molecular Formula: | C3H8 S2 |
| Molecular Weight: | 108.23 |
| InChI: | InChI=1/C3H8S2/c1-3(5)2-4/h3-5H,2H2,1H3/t3-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1228 |
| Density: | 1,063 g/cm3 |
| Refractive index: | 1.506 |
| Specification: |
1,2-Propanedithiol (CAS No.814-67-5) is a thiol with the formula HSCH2CH(SH)CH3. This colorless, intensely odorous liquid is the simplest chiral dithiol. Related dithiols include 1,2-ethanedithiol, 2,3-dimercapto-1-propanesulfonic acid, and 1,3-propanedithiol. It is generated by the addition of H2S to the related episulfide, CH3CHCH2S. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
