| Identification | |
| Name: | Acryloyl chloride |
| Synonyms: | Propenoyl chloride |
| CAS: | 814-68-6 |
| EINECS: | 212-399-0 |
| Molecular Formula: | C3H3ClO |
| Molecular Weight: | 90.51 |
| InChI: | InChI=1/C3H3ClO/c1-2-3(4)5/h2H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.114 |
| Stability: | Stable, but reacts violently with water. Incompatible with alcohols, oxidizing agents, strong bases. Light-sensitive. Highly flammable. |
| Refractive index: | n20/D 1.435(lit.) |
| Solubility: | Soluble |
| Appearance: | clear liquid |
| Packinggroup: | II |
| HS Code: | 29161980 |
| Sensitive: | Moisture & Light Sensitive |
| Color: | Liquid |
| Usage: | Monomer, intermediate. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
