| Identification |
| Name: | Levlofexidine |
| Synonyms: | Levlofexidine;(R)-Lofexidine;2-[(1R)-1-(2,6-Dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole;(-)-2-[(R)-1-(2,6-Dichlorophenoxy)ethyl]-2-imidazoline |
| CAS: | 81447-78-1 |
| Molecular Formula: | C11H12Cl2N2O |
| Molecular Weight: | 259.135 |
| InChI: | InChI=1/C11H12Cl2N2O/c1-7(11-14-5-6-15-11)16-10-8(12)3-2-4-9(10)13/h2-4,7H,5-6H2,1H3,(H,14,15)/t7-/m1/s1 |
| Molecular Structure: |
![(C11H12Cl2N2O) Levlofexidine;(R)-Lofexidine;2-[(1R)-1-(2,6-Dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole;(-)-2-[(...](https://img.guidechem.com/structure/81447-78-1.gif) |
| Properties |
| Flash Point: | 208.7°C |
| Boiling Point: | 421.5°C at 760 mmHg |
| Density: | 1.39g/cm3 |
| Refractive index: | 1.61 |
| Flash Point: | 208.7°C |
| Usage: | The R-enantiomer of Lofexidine. a2-Adrenoceptor agonist related structurally to Clonidine. Used in treatment of opioid withdrawal symptoms; antihypertensive. |
| Safety Data |
| |
 |
