| Identification | |
| Name: | Urea,N-nitroso-N-propyl- |
| Synonyms: | Urea,1-nitroso-1-propyl- (7CI,8CI); 1-Nitroso-1-propylurea; 1-Propyl-1-nitrosourea;1-n-Propyl-1-nitrosourea; N-(n-Propyl)-N-nitrosourea; N-Nitroso-N-propylurea;N-Propyl-N-nitrosourea; NPU; NSC 46792 |
| CAS: | 816-57-9 |
| Molecular Formula: | C4H9 N3 O2 |
| Molecular Weight: | 131.16 |
| InChI: | InChI=1/C4H9N3O2/c1-2-3-7(6-9)4(5)8/h2-3H2,1H3,(H2,5,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 74.9°C |
| Boiling Point: | 200.3°C at 760 mmHg |
| Density: | 1.27g/cm3 |
| Stability: | Unstable at RT, Contains 40% Water, 1.8% Acetic Acid |
| Refractive index: | 1.524 |
| Specification: | usageEng:Precursor of Diazopropane. Carcinogen |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 74.9°C |
| Storage Temperature: | -20?C Freezer, Under Inert Atmosphere |
| Usage: | Precursor of Diazopropane. Carcinogen |
| Safety Data | |
 |
|
