| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, 2-methyl-2-propen-1-yl ester |
| Synonyms: | 2-Propenoicacid, 2-methyl-, 2-methyl-2-propenyl ester (9CI);Methacrylic acid,2-methylallyl ester (7CI,8CI);2-Propen-1-ol, 2-methyl-, methacrylate (7CI);Allyl alcohol, 2-methyl-, methacrylate (8CI);2-Methyl-2-propen-1-olmethacrylate;2-Methyl-2-propenyl methacrylate;2-Methylallyl methacrylate;Methallyl methacrylate;NSC 24161; |
| CAS: | 816-74-0 |
| Molecular Formula: | C8H12O2 |
| Molecular Weight: | 140.18 |
| InChI: | InChI=1/C8H12O2/c1-6(2)5-10-8(9)7(3)4/h1,3,5H2,2,4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.911 g/cm3 |
| Refractive index: | 1.433 |
| Specification: |
The Methallyl methacrylate, with the CAS registry number 816-74-0, has the systematic name of 2-methylprop-2-en-1-yl 2-methylprop-2-enoate. It belongs to the product category of Monermer. And the molecular formula of the chemical is C8H12O2. The characteristics of this chemical are as followings: (1)ACD/LogP: 2.65; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 26.3 Å2; (7)Index of Refraction: 1.433; (8)Molar Refractivity: 40.02 cm3; (9)Molar Volume: 153.8 cm3; (10)Polarizability: 15.86×10-24cm3; (11)Surface Tension: 25.4 dyne/cm; (12)Density: 0.911 g/cm3; (13)Flash Point: 59 °C; (14)Enthalpy of Vaporization: 40.68 kJ/mol; (15)Boiling Point: 170.4 °C at 760 mmHg; (16)Vapour Pressure: 1.47 mmHg at 25°C. Uses of Methallyl methacrylate: It can react with dithiophosphoric acid O,O'-diethyl ester to produce 3-(diethoxy-thiophosphorylsulfanyl)-2-methyl-propionic acid 2-methyl-allyl ester. This reaction will need reagent hydroquinone monomethyl ether, and the yield is about 75%. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
