Identification |
Name: | L-Cysteine,N-acetyl-S-(3-amino-3-oxopropyl)- |
Synonyms: | N-Acetyl-S-(3-amino-3-oxopropyl)-L-cysteine; |
CAS: | 81690-92-8 |
Molecular Formula: | C8H14N2O4S |
Molecular Weight: | 234.27276 |
InChI: | InChI=1S/C8H14N2O4S/c1-5(11)10-6(8(13)14)4-15-3-2-7(9)12/h6H,2-4H2,1H3,(H2,9,12)(H,10,11)(H,13,14)/t6-/m0/s1 |
Molecular Structure: |
|
Properties |
Melting Point: | 107-110ºC |
Flash Point: | 330.9 ºC |
Boiling Point: | 623.6 ºCat 760 mmHg |
Density: | 1.328 g/cm3 |
Refractive index: | 1.545 |
Water Solubility: | Soluble in water |
Solubility: | Soluble in water |
Appearance: | White solid |
Specification: | usageEng:N-Acetyl-S-(carbamoylethyl)-L-cysteine is the urinary metabolite of Acrylamide (AA). Acrylamide is formed during the heating of food and is classified as a genotoxic carcinogen. |
Flash Point: | 330.9 ºC |
Usage: | N-Acetyl-S-(carbamoylethyl)-L-cysteine is the urinary metabolite of Acrylamide (AA). Acrylamide is formed during the heating of food and is classified as a genotoxic carcinogen. |
Safety Data |
|
|