| Identification | |
| Name: | Clomazone |
| Synonyms: | Cirrus;Cirrus 50WP;Clomazone;Command;Command (pesticide);Command 3ME;Command EC;Dimethazone;F 57020;FMC 57020; |
| CAS: | 81777-89-1 |
| Molecular Formula: | C12H14 Cl N O2 |
| Molecular Weight: | 239.698 |
| InChI: | InChI=1S/C12H14ClNO2/c1-12(2)8-16-14(11(12)15)7-9-5-3-4-6-10(9)13/h3-6H,7-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2902 |
| Density: | 1.192 |
| Refractive index: | 1.55 |
| Solubility: | in water: 1.1g / L, very soluble in acetone, acetonitrile, chloroform, cyclohexanone, methylene chloride, methanol, toluene and other organic solvents. |
| Specification: |
?Clomazone , its cas register number is 81777-89-1. It also can be called?2-((2-Chlorophenyl)methyl)-4,4-dimethyl-3-isoxazolidinon ; 2-(2-Chlorobenzyl)-4,4-dimethyl-3-isoxazolidinone ; Command ; Commence ; Dimethazone ; Gamit ; 2-(2-Chlorobenzyl)-4,4-dimethyl-1,2-oxazolidin-3-one . And its classification code are Agricultural Chemical?and??Herbicide. |
| Packinggroup: | III |
| Color: | Clear colorless to light brown viscous liquid |
| Safety Data | |
| Hazard Symbols | |
 |
|
