| Identification |
| Name: | 2-Hydroxyethyl acrylate |
| Synonyms: | Hydroxyethyl acrylate; HEA; 2-(Acryloyloxy)ethanol; 2-Hydroxyethylester kyseliny akrylove; 2-hydroxyethylesterkyselinyakrylove; 2-Propenoicacid,2-hydroxyethylester; beta-Hydroxyethyl acrylate; beta-hydroxyethylacrylate; Bisomer 2HEA; bisomer2hea; HEA |
| CAS: | 818-61-1 |
| EINECS: | 212-454-9 |
| Molecular Formula: | C5H8O3 |
| Molecular Weight: | 116.12 |
| InChI: | InChI=1/C5H8O3/c1-2-5(7)8-4-3-6/h2,6H,1,3-4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2922 |
| Density: | 1.106 |
| Stability: | table only if stored and handled under recommended conditions. The stability of the product depends upon the availability of both dissolved oxygen and MEHQ inhibitor (CAS=150-76-5). The presence of oxygen is necessary for the MEHQ to function effectively. The product should never be stored under an inert gas atmosphere, but should always be stored under an atmosphere containing 5-21% oxygen by volume. |
| Refractive index: | 1.449-1.451 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | A colorless to light yellow liquid. |
| Packinggroup: | II |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool place in the original container and protect from sunlight. Keep refrigerated. (Store below 4C.) Store in a tightly closed container. Store protected from moisture. Store protected from light. |
| Color: | Liquid |
| Usage: | Chemical intermediate for polymers, comonomer in acrylic surface coatings. |
| Safety Data |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
| |
 |
