| Identification | |
| Name: | Butenyl-1,1''-biphenyl, isomer mixture |
| Synonyms: | Butenyl-1,1''-biphenyl, isomer mixture |
| CAS: | 81846-81-3 |
| Molecular Formula: | C16H18 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C16H18/c1-3-13(2)14-9-11-16(12-10-14)15-7-5-4-6-8-15/h4-13H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 69 deg C |
| Flash Point: | 146.21°C |
| Boiling Point: | 310.548°C at 760 mmHg |
| Density: | 0.95g/cm3 |
| Refractive index: | 1.542 |
| Solubility: | Soluble in ethanol, ethyl ether; very soluble in benzene, carbon tetrachloride, carbon disulfide, and methanol. Soluble in alcohol, ether; very soluble in benzene Soluble in oxygenated and chlorinated solvents. In water, 7.48 mg/L at 25 deg C |
| Flash Point: | 146.21°C |
| Color: | White scales Colorless leaflets Pure biphenyl is a white crystalline solid that separates from solvents as plates or monoclinic prismatic crystals. Commercial samples are often slightly yellow or tan in color. |
| Safety Data | |
 |
|
