Identification |
Name: | diethyl sulphate, compound with N-methyl-N-[4-[(1-methyl-1H-1,2,4-triazol-3-yl)azo]phenyl]benzylamine (1:1) |
Synonyms: | Diethyl sulphate, compound with N-methyl-N-(4-((1-methyl-1H-1,2,4-triazol-3-yl)azo)phenyl)benzylamine (1:1);Sulfuric acid, dimethyl ester, compd. with N-methyl-N-(4-((1-methyl-1H-1,2,4-triazol-3-yl)azo)phenyl)benzenemethanamine (1:1);N-benzyl-N-methyl-4-[(1-methyl-1,2,4-triazol-3-yl)azo]aniline; diethyl sulfate |
CAS: | 81921-73-5 |
EINECS: | 279-850-1 |
Molecular Formula: | C21H28N6O4S |
Molecular Weight: | 460.5498 |
InChI: | InChI=1/C17H18N6.C4H10O4S/c1-22(12-14-6-4-3-5-7-14)16-10-8-15(9-11-16)19-20-17-18-13-23(2)21-17;1-3-7-9(5,6)8-4-2/h3-11,13H,12H2,1-2H3;3-4H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 347.1°C |
Boiling Point: | 650.2°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 347.1°C |
Safety Data |
|
 |