Identification |
Name: | Xanthene-9-carboxylic acid |
Synonyms: | xanthoic acid; Methyl xanthene-9-carboxylate; 9-Xanthene carboxylic acid; Xomthene-9-carboxylic methylester acid |
CAS: | 82-07-5 |
EINECS: | 201-394-9 |
Molecular Formula: | C14H10O3 |
Molecular Weight: | 226.23 |
InChI: | InChI=1/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16) |
Molecular Structure: |
 |
Properties |
Transport: | 2811 |
Density: | 1.335 g/cm3 |
Specification: |
Xanthene-9-carboxylic acid ,its cas register number is 82-07-5. It also can be called 9-Xanthenecarboxylic acid ; 9H-Xanthene-9-carboxylic acid ; Xanthenecarboxylic acid and Xanthanoic acid .
|
Safety Data |
|
 |