| Identification | |
| Name: | 9,10-Anthracenedione,1-methoxy- |
| Synonyms: | Anthraquinone,1-methoxy- (6CI,7CI,8CI); 1-Methoxy-9,10-anthraquinone;1-Methoxyanthracene-9,10-dione; 1-Methoxyanthraquinone; NSC 400205 |
| CAS: | 82-39-3 |
| EINECS: | 201-418-8 |
| Molecular Formula: | C15H10 O3 |
| Molecular Weight: | 238.25 |
| InChI: | InChI=1/C15H10O3/c1-18-12-8-4-7-11-13(12)15(17)10-6-3-2-5-9(10)14(11)16/h2-8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 194.1°C |
| Boiling Point: | 429.3°C at 760 mmHg |
| Density: | 1.301g/cm3 |
| Refractive index: | 1.632 |
| Specification: |
1-Methoxyanthraquinone with cas registry number of 82-39-3 is also known as 1-Methoxy-9,10-anthracenedione ; 1-Methoxy-9,10-anthraquinone ; 1-Methoxyanthraquinone ; 1-Methoxyanthraquinone ; 9,10-Anthracenedione,1-methoxy- ; Anthraquinone,1-methoxy- . A process for the production of 1-Methoxyanthraquinone of high purity by reaction of nitroanthraquinones with methanol and alkali, in the presence of alkali-resistant nitrous acid inhibitors. 1-Methoxyanthraquinone with cas registry number of 82-39-3 is used as an intermediate. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 194.1°C |
| Safety Data | |
 |
|
