| Identification |
| Name: | pentachloronitrobenzene |
| Synonyms: | 101brandpcnb75wettable; ai-23024; Avicol; avicol(pesticide); Avicol, pesticide; Batrilex; Benzene,pentachloronitro-; Botrilex |
| CAS: | 82-68-8 |
| EINECS: | 201-435-0 |
| Molecular Formula: | C6Cl5NO2 |
| Molecular Weight: | 295.34 |
| InChI: | InChI=1/C6Cl5NO2/c7-1-2(8)4(10)6(12(13)14)5(11)3(1)9 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 40kgs |
| Flash Point: | 11 °C |
| Density: | 1.718 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Water Solubility: | Insoluble |
| Solubility: | insoluble soluble in carbon disulfide, benzene, chloroform and chlorinated hydrocarbons; slightly soluble in ethanol. |
| Appearance: | white to pale yellow solid |
| Flash Point: | 11 °C |
| Storage Temperature: | APPROX 4°C |
| Color: | yellow to tan |
| Usage: | Intermediate, slime prevention in industrial water, herbicide. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
N:Dangerousfortheenvironment
|
| |
 |
