| Identification | |
| Name: | (Z)-Hymenialdisine |
| Synonyms: | Pyrrolo[2,3-c]azepin-8(1H)-one,4-(2-amino-1,5-dihydro-5-oxo-4H-imidazol-4-ylidene)-2-bromo-4,5,6,7-tetrahydro-,(Z)-;Hymenialdesine;Hymenialdisine; |
| CAS: | 82005-12-7 |
| Molecular Formula: | C11H10BrN5O2 |
| Molecular Weight: | 324.1334 |
| InChI: | InChI=1S/C11H10BrN5O2/c12-6-3-5-4(7-10(19)17-11(13)16-7)1-2-14-9(18)8(5)15-6/h3,15H,1-2H2,(H,14,18)(H3,13,16,17,19)/b7-4+ |
| Molecular Structure: | ![(C11H10BrN5O2) Pyrrolo[2,3-c]azepin-8(1H)-one,4-(2-amino-1,5-dihydro-5-oxo-4H-imidazol-4-ylidene)-2-bromo-4,5,6,7-t...](https://img1.guidechem.com/chem/e/dict/189/82005-12-7.jpg) |
| Properties | |
| Melting Point: | 160-164 ºC |
| Density: | 2.2 g/cm3 |
| Refractive index: | 1.911 |
| Water Solubility: | Soluble in DMSO. |
| Solubility: | Soluble in DMSO. |
| Appearance: | Light Yellow Solid |
| Specification: | Light Yellow Solid usageEng:A potent inhibitor of a variety of kinases including MEK-1, GSK-3, and CKI. It also exhibits inhibition of the G2 cell cycle checkpoint at the micromolar concentrations. A marine sponge alkaloid, a natural product |
| Usage: | A potent inhibitor of a variety of kinases including MEK-1, GSK-3, and CKI. It also exhibits inhibition of the G2 cell cycle checkpoint at the micromolar concentrations. A marine sponge alkaloid, a natural product |
| Safety Data | |
 |
|
