| Identification | |
| Name: | Epalrestat |
| Synonyms: | 2-[(5Z)-5-[(E)-2-methyl-3-phenyl-prop-2-enylidene]-4-oxo-2-sulfanylidene-thiazolidin-3-yl]acetic acid;3-Thiazolidineacetic acid,5-[(2E)-2-methyl-3-phenyl-2-propenylidene]- 4-oxo-2-thioxo-,(5Z)-;3-Thiazolidineacetic acid, 5-(2-methyl-3-phenyl-2-propenylidene)-4-oxo-2-thioxo-, (E,E)-;Kinedak;Epalrestat (JAN);5-((Z,E)-beta-Methylcinnamylidene)-4-oxo-2-thioxo-3-thiazolidineacetic acid;Epalrestat [INN];Kinedak (TN);Ono 2235;Epalrestatum [Latin];Properties: orange red crystalline powder, with special odor;Epalrestate;Epatrestat; |
| CAS: | 82159-09-9 |
| Molecular Formula: | C15H13NO3S2 |
| Molecular Weight: | 319.39862 |
| InChI: | InChI=1S/C15H13NO3S2/c1-10(7-11-5-3-2-4-6-11)8-12-14(19)16(9-13(17)18)15(20)21-12/h2-8H,9H2,1H3,(H,17,18)/b10-7+,12-8- |
| Molecular Structure: | ![(C15H13NO3S2) 2-[(5Z)-5-[(E)-2-methyl-3-phenyl-prop-2-enylidene]-4-oxo-2-sulfanylidene-thiazolidin-3-yl]acetic aci...](https://img.guidechem.com/casimg/82159-09-9.gif) |
| Properties | |
| Melting Point: | 210-217 oC |
| Flash Point: | 266.4 oC |
| Boiling Point: | 516.8 oC at 760 mmHg |
| Density: | 1.43 g/cm3 |
| Refractive index: | 1.705 |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | Deep red acicular crystal |
| Specification: |
?Epalrestat , its cas register number is 82159-09-9. It also can be called {(5Z)-5-[(2E)-2-Methyl-3-phenylprop-2-en-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid ; 5-((Z,E)-beta-Methylcinnamylidene)-4-oxo-2-thioxo-3-thiazolidineacetic acid ; and Epalrestatum?.?Epalrestat (82159-09-9) should be stored in original container in a cool dark place. |
| Flash Point: | 266.4 oC |
| Storage Temperature: | Store in original container in a cool dark place. |
| Usage: | An aldose reductase inhibitor. |
| Safety Data | |
 |
|
