| Identification | |
| Name: | Cyclohexanone,2-chloro- |
| CAS: | 822-87-7 |
| EINECS: | 212-505-5 |
| Molecular Formula: | C6H9ClO |
| Molecular Weight: | 132.59 |
| InChI: | InChI=1/C6H9ClO/c7-5-3-1-2-4-6(5)8/h5H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3335 9 |
| Density: | 1.161 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.483-1.485 |
| Solubility: | Soluble |
| Appearance: | White - clear brown liquid above room te. Aromatic odor. |
| Specification: | clear brown liquid Safety Statements:26-36/37-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | 2-8°C |
| Color: | colorless to very deep brown |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
