| Identification | |
| Name: | Etomoxir |
| Synonyms: | 2-[6-(4-Chlorophenoxy)hexyl]-2-oxiranecarboxylic acid ethyl ester;2-[6-(4-Chlorophenoxy)hexyl]oxirane-2-carboxylic acid ethyl ester;rac- Etomoxir |
| CAS: | 82258-36-4 |
| Molecular Formula: | C17H23ClO4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C17H23ClO4/c1-2-20-16(19)17(13-22-17)11-5-3-4-6-12-21-15-9-7-14(18)8-10-15/h7-10H,2-6,11-13H2,1H3 |
| Molecular Structure: | ![(C17H23ClO4) 2-[6-(4-Chlorophenoxy)hexyl]-2-oxiranecarboxylic acid ethyl ester;2-[6-(4-Chlorophenoxy)hexyl]oxiran...](https://img.guidechem.com/structure/82258-36-4.gif) |
| Properties | |
| Flash Point: | 142.6°C |
| Boiling Point: | 405°C at 760 mmHg |
| Density: | 1.163g/cm3 |
| Refractive index: | 1.519 |
| Specification: | Low Melting amorphous Solid usageEng:An inhibitor of carnitine palmitoyltransferase A (CPT1), which is required for the oexidation of long-chain acyl CoA esters. A strong inhibitor of mitochondrial CPT1 and is a candidate as an anti-diabetic drug. |
| Flash Point: | 142.6°C |
| Usage: | An inhibitor of carnitine palmitoyltransferase A (CPT1), which is required for the oexidation of long-chain acyl CoA esters. A strong inhibitor of mitochondrial CPT1 and is a candidate as an anti-diabetic drug. |
| Safety Data | |
 |
|
