| Identification |
| Name: | 2-Ethyl-1,3-cyclopentanedione |
| Synonyms: | 2-Ethylcyclopentane-1,3-dione;UNII-91A82TE3OS;1,3-Cyclopentanedione, 2-ethyl-; |
| CAS: | 823-36-9 |
| EINECS: | 212-512-3 |
| Molecular Formula: | C7H10O2 |
| Molecular Weight: | 126.15 |
| InChI: | InChI=1/C7H10O2/c1-2-5-6(8)3-4-7(5)9/h5H,2-4H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | HAZARD |
| Density: | 1.057 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.53 |
| Solubility: | |
| Appearance: | yellow crystalline powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Do not expose to air. Store under an inert atmosphere. Freeze Store under argon. |
| Safety Data |
| |
 |
