| Identification | |
| Name: | 4-Pyridazinamine,3,6-dichloro- |
| Synonyms: | Pyridazine,4-amino-3,6-dichloro- (6CI,7CI,8CI); 3,6-Dichloropyridazin-4-amine;4-Amino-3,6-dichloropyridazine; NSC 170664 |
| CAS: | 823-58-5 |
| Molecular Formula: | C4H3 Cl2 N3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C4H3Cl2N3/c5-3-1-2(7)4(6)9-8-3/h1H,(H2,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.606g/cm3 |
| Refractive index: | 1.633 |
| Specification: |
The IUPAC name of 3,6-Dichloropyridazin-4-amine is 3,6-dichloropyridazin-4-amine. With the CAS registry number 823-58-5, it is also named as 4-Pyridazinamine,3,6-dichloro-. In addition, its molecular formula is C4H3Cl2N3 and its molecular weight is 163.99. The other characteristics of 3,6-Dichloropyridazin-4-amine can be summarized as: (1)ACD/LogP: 1.80; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.8; (4)ACD/LogD (pH 7.4): 1.8; (5)ACD/BCF (pH 5.5): 13.69; (6)ACD/BCF (pH 7.4): 13.7; (7)ACD/KOC (pH 5.5): 226.47; (8)ACD/KOC (pH 7.4): 226.64; (9)H bond acceptors: 3; (10)H bond donors: 2; (11)Freely Rotating Bonds: 1; (12)Polar Surface Area: 29.02 Å2; (13)Index of Refraction: 1.633; (14)Molar Refractivity: 36.46 cm3; (15)Molar Volume: 102 cm3; (16)Polarizability: 14.45×10-24cm3; (17)Surface Tension: 68 dyne/cm; (18)Density: 1.606 g/cm3; (19)Flash Point: 173.3 °C; (20)Enthalpy of Vaporization: 60.9 kJ/mol; (21)Boiling Point: 363 °C at 760 mmHg; (22)Vapour Pressure: 1.86E-05 mmHg at 25 °C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
