| Identification | |
| Name: | Sodium toluene-4-sulphinate |
| Synonyms: | Benzenesulfinicacid, 4-methyl-, sodium salt (9CI);p-Toluenesulfinic acid, sodium salt(6CI,8CI);4-Methylbenzenesulfinic acid sodium salt;NSC 4871;NSC 9077;Sodium4-methylbenzenesulfinate;Sodium 4-toluenesulfinate;Sodiump-methylbenzenesulfinate;Sodium p-toluenesulfinate;Sodium p-tolylsulfinate; |
| CAS: | 824-79-3 |
| EINECS: | 212-538-5 |
| Molecular Formula: | C7H8O2S.Na |
| Molecular Weight: | 178.18405 |
| InChI: | InChI=1S/C7H8O2S.Na/c1-6-2-4-7(5-3-6)10(8)9;/h2-5H,1H3,(H,8,9);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | white to off-white crystalline powder |
| Specification: |
?Sodium toluene-4-sulphinate , its CAS NO. is 824-79-3, the synonyms are p-Toluenesulfinic acid sodium salt ; 4-Toluenesulfinic acid sodium salt ; Sodium p-toluene sulfinate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
