| Identification | |
| Name: | 3-Methoxybenzyl chloride |
| Synonyms: | 1-Chloromethyl-3-methoxybenzene; alpha-Chloro-3-methoxytoluene |
| CAS: | 824-98-6 |
| EINECS: | 212-541-1 |
| Molecular Formula: | C8H9ClO |
| Molecular Weight: | 156.61 |
| InChI: | InChI=1/C8H9ClO/c1-10-8-4-2-3-7(5-8)6-9/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.078 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.543-1.545 |
| Solubility: | Insoluble |
| Appearance: | clear colorless to light yellow liquid |
| Specification: |
3-Methoxybenzyl chloride , its cas register number is 824-98-6. It also can be called 1-Chloromethyl-3-methoxybenzene; 3-(Chloromethyl)anisole ; (3-Methoxyphenyl)methyl chloride ; 1-(Chloromethyl)-3-methoxybenzene ; a-Chloro-m-methoxytoluene ; m-(Chloromethyl)anisole ; m-Methoxybenzyl chloride .It is a clear colorless to light yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29093090 |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
