| Identification | |
| Name: | 7H-Pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylicacid, 9,10-difluoro-2,3-dihydro-3-methyl-7-oxo- |
| Synonyms: | 9,10-Difluoro-3-methyl-7-oxo-2,3-dihydro-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylicacid; |
| CAS: | 82419-35-0 |
| Molecular Formula: | C13H9F2NO4 |
| Molecular Weight: | 281.21 |
| InChI: | InChI=1/C13H9F2NO4/c1-5-4-20-12-9(15)8(14)2-6-10(12)16(5)3-7(11(6)17)13(18)19/h2-3,5H,4H2,1H3,(H,18,19)/p-1/t5-/m1/s1 |
| Molecular Structure: | ![(C13H9F2NO4) 9,10-Difluoro-3-methyl-7-oxo-2,3-dihydro-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylicacid;](https://img.guidechem.com/casimg/82419-35-0.gif) |
| Properties | |
| Melting Point: | 320-322 °C(lit.) |
| Flash Point: | 231.5°C |
| Boiling Point: | 459.2°C at 760 mmHg |
| Density: | 1.61 g/cm3 |
| Appearance: | grey-yellow powder |
| Specification: | Grey-Yellow Powder usageEng:Ofloxacin intermediate Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 231.5°C |
| Storage Temperature: | -20?C Freezer |
| Usage: | Ofloxacin intermediate |
| Safety Data | |
 |
|
