| Identification | |
| Name: | Ethanol, 2-(butylnitroamino)-, nitrate (ester) |
| Synonyms: | 2-(butylnitroamino)ethyl nitrate;BRN 1793241;2-(N-NITROBUTYLAMINO)ETHYLNITRATE;N-BUTYL-2-NITRATOETHYLNITRAMINE;N-Butyl-N-(2-nitrooxyethyl)nitroamine;Nitric acid 2-(N-nitrobutylamino)ethyl ester;Nitric acid 2-[nitro(butyl)amino]ethyl ester;2-(Butylnitroamino)ethanol nitrate (ester) |
| CAS: | 82486-82-6 |
| EINECS: | 279-976-7 |
| Molecular Formula: | C6H13N3O5 |
| Molecular Weight: | 207.18452 |
| InChI: | InChI=1/C6H13N3O5/c1-2-3-4-7(8(10)11)5-6-14-9(12)13/h2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 163.7°C |
| Boiling Point: | 347.1°C at 760 mmHg |
| Density: | 1.242g/cm3 |
| Refractive index: | 1.479 |
| Specification: |
Ethanol, 2-(butylnitroamino)-, nitrate (ester) with CAS Registry Number of 82486-82-6 is also called for 2-(Butylnitroamino)ethanol nitrate (ester) ; 2-(Butylnitroamino)ethyl nitrate ; 4-04-00-03414 (Beilstein Handbook Reference) ; CCRIS 6516 ; N-Butyl-2-nitratoethyl nitramine ; N-Butyl-2-nitratoethylnitramine ; Ethanol, 2-(butylnitroamino)-, nitrate (ester) . |
| Flash Point: | 163.7°C |
| Safety Data | |
 |
|
