| Identification | |
| Name: | Himic anhydride |
| Synonyms: | 3a,4,7,7a-Tetrahydro-4,7-methanoisobenzofuran-1,3-dione; 5-Norbornene-2,3-dicarboxylic anhydride; Bicyclo2.2.1-5-heptene-2,3-dicarboxylic Anhydride; Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic anhydride; Carbic anhydride; Nadic anhydride; 1,2,3,6-tetrahydro-3,6-methanophthalic anhydride; 3,6-Endomethylene-1,2,3,6-tetrahydrophthalic anhydride |
| CAS: | 826-62-0 |
| EINECS: | 212-557-9 |
| Molecular Formula: | C9H8O3 |
| Molecular Weight: | 164.16 |
| InChI: | InChI=1/C9H8O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-2,4-7H,3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Flash Point: | 163.8°C |
| Boiling Point: | 331.1°C at 760 mmHg |
| Density: | 1.405g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Reacts with water to form corresponding acid. |
| Refractive index: | 1.583 |
| Solubility: | Soluble |
| Appearance: | White solid. |
| Packinggroup: | I; II; III |
| Flash Point: | 163.8°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
