| Identification | |
| Name: | 2-Vinylnaphthalene |
| Synonyms: | Naphthalene,2-vinyl- (8CI);(2-Naphthyl)ethylene;(Naphthalen-2-yl)ethene;2-Ethenylnaphthalene; |
| CAS: | 827-54-3 |
| EINECS: | 212-573-6 |
| Molecular Formula: | C12H10 |
| Molecular Weight: | 154.21 |
| InChI: | InChI=1/C12H10/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2-9H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 115.5ºC |
| Density: | 1.031 g/cm3 |
| Stability: | No data. |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | White to light beige crystalline powder. |
| Specification: |
The chemical stability of 2-Vinylnaphthalene (CAS NO.827-54-3) is not available ,and conditions to avoid is not available. |
| Flash Point: | 115.5ºC |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
