| Identification | |
| Name: | 4-Aminoantipyrene |
| Synonyms: | 3H-Pyrazol-3-one, 4-amino-1,2-dihydro-1,5-dimethyl-2-phenyl-; Metapirazone; 4-Amino-1,5-dimethyl-2-phenyl-4-pyrazolin-3-one; 4-Amino-2,3-dimethyl-1-phenyl-3-pyrazolin-5-one; Aminoantipyrene; 4-Aminoantipyrine; 4-Aminophenazone; 4-Amino-1,5-dimethyl-2-phenyl-3-pyrazolone; Ampyrone |
| CAS: | 83-07-8 |
| EINECS: | 201-452-3 |
| Molecular Formula: | C11H13N3O |
| Molecular Weight: | 203.24 |
| InChI: | InChI=1/C11H13N3O/c1-8-10(12)11(15)14(13(8)2)9-6-4-3-5-7-9/h3-7H,12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Boiling Point: | 340 C |
| Density: | 0.8 |
| Stability: | Stable. May be light sensitive. |
| Refractive index: | 1.606 |
| Solubility: | Soluble |
| Appearance: | Pale yellow crystals |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29331190 |
| Storage Temperature: | Store at RT. |
| Usage: | A metabolite of aminopyrine, having both analgesic and anti-inflammatory properties. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
