| Identification | |
| Name: | N-Acetylaminoantipyrine |
| Synonyms: | N-(2,3-dimethyl-5-oxo-1-phenyl-3-pyrazolin-4-yl)acetamide; 4-acetamidophenazone |
| CAS: | 83-15-8 |
| EINECS: | 201-457-0 |
| Molecular Formula: | C13H15N3O2 |
| Molecular Weight: | 245.28 |
| InChI: | InChI=1/C13H15N3O2/c1-9-12(14-10(2)17)13(18)16(15(9)3)11-7-5-4-6-8-11/h4-8H,1-3H3,(H,14,17) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.26 g/cm3 |
| Refractive index: | 1.62 |
| Appearance: | yellow powder |
| Specification: | yellow powder usageEng:A metabolite of Metamizol. Metabolism of Metamizol in early stages of the incubated hen's egg. Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Usage: | A metabolite of Metamizol. Metabolism of Metamizol in early stages of the incubated hen's egg. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
