Identification |
Name: | Acenaphthene |
Synonyms: | 1,8-Ethylenenaphthalene;1,2-Dihydroacenaphthene; |
CAS: | 83-32-9 |
EINECS: | 201-469-6 |
Molecular Formula: | C12H10 |
Molecular Weight: | 154.21 |
InChI: | InChI=1/C10H8.C2H4/c1-2-6-10-8-4-3-7-9(10)5-1;1-2/h1-8H;1-2H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3077 |
Density: | 1.069 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Refractive index: | 1.6048 |
Water Solubility: | 0.000347 G/100 ML |
Solubility: | Insoluble SOLVENT |
Appearance: | white to light yellowish solid |
Packinggroup: | III |
HS Code: | 29029080 |
Color: | brown-beige |
Usage: | Dye intermediate, manufacture plastics, insecticide, fungicide. |
Safety Data |
Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
T: Toxic
F: Flammable
Xn: Harmful
|
|
 |