| Identification |
| Name: | Acenaphthene |
| Synonyms: | 1,8-Ethylenenaphthalene;1,2-Dihydroacenaphthene; |
| CAS: | 83-32-9 |
| EINECS: | 201-469-6 |
| Molecular Formula: | C12H10 |
| Molecular Weight: | 154.21 |
| InChI: | InChI=1/C10H8.C2H4/c1-2-6-10-8-4-3-7-9(10)5-1;1-2/h1-8H;1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3077 |
| Density: | 1.069 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.6048 |
| Water Solubility: | 0.000347 G/100 ML |
| Solubility: | Insoluble SOLVENT |
| Appearance: | white to light yellowish solid |
| Packinggroup: | III |
| HS Code: | 29029080 |
| Color: | brown-beige |
| Usage: | Dye intermediate, manufacture plastics, insecticide, fungicide. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
T: Toxic
F: Flammable
Xn: Harmful
|
| |
 |
