| Identification | |
| Name: | 1,5-Dihydroxy naphthalene |
| Synonyms: | 1,5-Dihydroxynaphthaline;1,5-Naphthohydroquinone;C.I. 76625;DurafurDeveloper E;1,5-Naphthalenediol;Oxidation Base; |
| CAS: | 83-56-7 |
| EINECS: | 201-487-4 |
| Molecular Formula: | C10H8O2 |
| Molecular Weight: | 160.17 |
| InChI: | InChI=1/C10H8O2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1-6,11-12H |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 375.4 oC at 760 mmHg |
| Density: | 1.33 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.725 |
| Water Solubility: | slightly soluble AUTOIGNITION |
| Solubility: | slightly soluble AUTOIGNITION |
| Appearance: | gray to brown powder |
| Specification: |
?1,5-Dihydroxy naphthalene (CAS NO.83-56-7), its Synonyms are 1,6-Naphthalenediol ; CI 76625 ; Durafur Developer E ; Oxidation Base ; 1,5-Naphthalenediol . It is gray powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29072900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
