| Identification |
| Name: | 4-Phenoxyphenol |
| Synonyms: | Phenol,p-phenoxy- (6CI,7CI,8CI); 4-Hydroxydiphenyl ether;4-Phenoxyphenol; Hydroquinone monophenyl ether; NSC25027; p-Hydroxydiphenyl ether; p-Phenoxyphenol |
| CAS: | 831-82-3 |
| EINECS: | 212-611-1 |
| Molecular Formula: | C12H10O2 |
| Molecular Weight: | 186.21 |
| InChI: | InChI=1/C12H10O2/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,13H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.175 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.605 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water,toluene: 0.1 g/mL, clear |
| Appearance: | White or light yellow crystalline powder |
| Packinggroup: | I; II; III |
| HS Code: | 29095090 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Color: | colorless to light brown |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
