| Identification | |
| Name: | Ametryn |
| Synonyms: | 1,3,5-Triazine-2,4-diamine,N-ethyl-N'-(1-methylethyl)-6-(methylthio)- (9CI);s-Triazine, 2-(ethylamino)-4-(isopropylamino)-6-(methylthio)-(6CI,8CI);2-Ethylamino-4-isopropylamino-6-methylmercapto-s-triazine;2-Ethylamino-4-isopropylamino-6-methylthio-1,3,5-triazine;2-Ethylamino-4-isopropylamino-6-methylthio-s-triazine;2-Ethylamino-4-methylthio-6-isopropylamino-1,3,5-triazine;2-Methylmercapto-4-ethylamino-6-isopropylamino-s-triazine;2-Methylthio-4-ethylamino-6-isopropylamino-s-triazine;2-Methylthio-4-ethylamino-6-isopropylamino-sym-triazine;A 1093;Amephyt;Ametrex;Ametryne;Cemerin;Doruplant;Evik;G 34162;Gesapax;N-Ethyl-N'-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine;NSC163044;Primatol Z 80; |
| CAS: | 834-12-8 |
| EINECS: | 212-634-7 |
| Molecular Formula: | C9H17N5S |
| Molecular Weight: | 227.330 |
| InChI: | InChI=1S/C9H17N5S/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)15-4/h6H,5H2,1-4H3,(H2,10,11,12,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1230 3/PG 2 |
| Flash Point: | 193.5oC |
| Boiling Point: | 396.4oC at 760 mmHg |
| Density: | 1.15 g/cm3 |
| Stability: | Very stable over several yr of shelf life and only slight sensitivity to natural light and extreme temperatures. Evik 80w has a shelf life of at least 5 yr when stored in a dry place. |
| Refractive index: | 1.556 |
| Solubility: | 2.09E2 mg/L (25 C) |
| Appearance: | White Powder |
| Packinggroup: | I; II; III |
| Flash Point: | 193.5oC |
| Color: | White powder WHITE, CRYSTALLINE Colorless crystals |
| Usage: | Selective systemic herbicide, pre- and post-emergence control of most annual grasses and broad-leaved weeds. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
