Identification |
Name: | Methanone,(2-butyl-3-benzofuranyl)[4-[2-(ethylamino)ethoxy]-3,5-diiodophenyl]- |
Synonyms: | DAMI;Deethylamiodarone; Desethylamiodarone; LB 33020; N-Deethylamiodarone; N-Desethylamiodarone;N-Monodesethylamiodarone |
CAS: | 83409-32-9 |
Molecular Formula: | C23H25 I2 N O3 |
Molecular Weight: | 617.26 |
InChI: | InChI=1/C23H25I2NO3/c1-3-5-9-20-21(16-8-6-7-10-19(16)29-20)22(27)15-13-17(24)23(18(25)14-15)28-12-11-26-4-2/h6-8,10,13-14,26H,3-5,9,11-12H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.638 g/cm3 |
Refractive index: | 1.635 |
Usage: |
Desethylamiodarone (CAS NO.83409-32-9) is used as a metabolite of Amiodarone, and it is used for a non-selective ion channel blocker.
|
Safety Data |
|
 |