| Identification | |
| Name: | (S)-(-)-3-Amino-3-phenylpropionic acid hydrochloride |
| Synonyms: | Benzenepropanoicacid, b-amino-, hydrochloride, (S)-;Benzenepropanoic acid, b-amino-, hydrochloride, (bS)- (9CI);(S)-3-Amino-3-phenylpropionic acid hydrochloride;(S)-3-Amino-3-phenylpropionic acid; |
| CAS: | 83649-47-2 |
| Molecular Formula: | C9H12ClNO2 |
| Molecular Weight: | 201.65 |
| InChI: | InChI=1/C9H11NO2.ClH/c10-8(6-9(11)12)7-4-2-1-3-5-7;/h1-5,8H,6,10H2,(H,11,12);1H/t8-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 158.5°C |
| Boiling Point: | 338.4°C at 760 mmHg |
| Appearance: | white to light yellow crystal powde |
| Specification: |
(S)-(-)-3-Amino-3-phenylpropionic acid hydrochloride , with CAS number of 83649-47-2, can be called (3S)-3-Amino-3-phenylpropanoic acid hydrochloride (1:1) ; benzenepropanoic acid, beta-amino-, (betaS)-, hydrochloride (1:1) . (S)-(-)-3-Amino-3-phenylpropionic acid hydrochloride (CAS NO.83649-47-2) is hazardous, so the first aid measures and others should be known. The (S)-(-)-3-Amino-3-phenylpropionic acid hydrochloride (CAS NO.83649-47-2) can be stable under normal temperature and pressure conditions.It is not compatible with strong oxidizing agents and you must not take it with incompatible materials.And also prevent it to broken down into hazardous decomposition products: Oxides of nitrogen,carbon dioxide,carbon monoxide, hydrogen chloride. |
| Flash Point: | 158.5°C |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
