| Identification | |
| Name: | 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate |
| Synonyms: | 2-Amino-4-N-( beta -hydroxyethyl)amino anisole sulfate;2-((3-Amino-4-methoxyphenyl)amino)ethanol sulfate;2-Amino-4-hydroxy anisole sulfate;2-Amino-4-hydroxyethylaminoanisole sulfate;2-Amino-4-hydroxyethylamino- anisole sulfate;(3-Ammonio-4-methoxyphenyl)(2-hydroxyethyl)ammonium sulphate;Jarocol AHEA;2-amino-4-N-(Beta-hydroxyethyl) aminoanisole sulfate; |
| CAS: | 83763-48-8 |
| EINECS: | 280-734-8 |
| Molecular Formula: | C9H16N2O6S |
| Molecular Weight: | 280.29 |
| InChI: | InChI=1/C9H14N2O2.H2O4S/c1-13-9-3-2-7(6-8(9)10)11-4-5-12;1-5(2,3)4/h2-3,6,11-12H,4-5,10H2,1H3;(H2,1,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Melting Point: | 150-154ºC |
| Flash Point: | 316.7ºC |
| Boiling Point: | 600 ºC at 760 mmHg |
| Appearance: | white to off-white crystalline powder |
| Specification: |
5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate , with CAS number of 83763-48-8, can be called 2-[(3-Amino-4-methoxyphenyl)amino]ethanol sulfate (1:1) ; 2-[(3-Amino-4-methoxyphenyl)amino]ethanol sulfate (salt) ; 2-[(3-Amino-4-methoxyphenyl)amino]ethanolsulfat(salt) ; 2-Amino-4-hydroxyethylaminoanisole sulfate ; ethanol, 2-[(3-amino-4-methoxyphenyl)amino]-, sulfate (1:1) (salt) ; N~1~-(2-Hydroxyethyl)-4-methoxybenzene-1,3-diaminium sulfate . |
| Flash Point: | 316.7ºC |
| Safety Data | |
 |
|
