| Identification | |
| Name: | Homocysteine,S-ethenyl- |
| Synonyms: | DL-Homocysteine,S-ethenyl-; S-Vinyl-DL-homocysteine |
| CAS: | 83768-87-0 |
| Molecular Formula: | C6H11 N O2 S |
| Molecular Weight: | 161.24 |
| InChI: | InChI=1/C6H11NO2S/c1-2-10-4-3-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.3°C |
| Boiling Point: | 313.4°C at 760 mmHg |
| Density: | 1.191g/cm3 |
| Refractive index: | 1.542 |
| Specification: |
Removal in wastewater treatment of Vinthionine (CAS No.83768-87-0) can be stated as follows: |
| Flash Point: | 143.3°C |
| Safety Data | |
 |
|
