| Identification | |
| Name: | Benzenepropanoic acid,4-nitro-b-oxo-, ethyl ester |
| Synonyms: | Aceticacid, (p-nitrobenzoyl)-, ethyl ester (6CI,7CI,8CI); (4-Nitrobenzoyl)acetic acidethyl ester; (p-Nitrobenzoyl)acetic acid ethyl ester; 4-Nitro-b-oxobenzenepropanoic acid ethylester; Ethyl (4-nitrobenzoyl)acetate; Ethyl (p-nitrobenzoyl)acetate; Ethyl2-(4-nitrobenzoyl)acetate; Ethyl 3-(4-nitrophenyl)-3-oxopropanoate; Ethyl3-(4-nitrophenyl)-3-oxopropionate; NSC 62134 |
| CAS: | 838-57-3 |
| EINECS: | 212-656-7 |
| Molecular Formula: | C11H11 N O5 |
| Molecular Weight: | 237.21 |
| InChI: | InChI=1/C11H11NO5/c1-2-17-11(14)7-10(13)8-3-5-9(6-4-8)12(15)16/h3-6H,2,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.276 g/cm3 |
| Refractive index: | 1.542 |
| Appearance: | yellow crystalline powder |
| Specification: | yellow fine crystalline powder Safety Statements:24/25-36/37-26 24/25:Avoid contact with skin and eyes 36/37:Wear suitable protective clothing and gloves 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
