Identification |
Name: | L-lysine, compound with 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione (1:1) |
Synonyms: | Lysine theophylline;Lysine theophyllinate;L-Lysine, compd. with 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione (1:1);L-Lysine, compound with 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione (1:1);L-lysine - 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione (1:1) |
CAS: | 83920-54-1 |
EINECS: | 281-314-7 |
Molecular Formula: | C13H22N6O4 |
Molecular Weight: | 326.3516 |
InChI: | InChI=1/C7H8N4O2.C6H14N2O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;7-4-2-1-3-5(8)6(9)10/h3H,1-2H3,(H,8,9);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
Molecular Structure: |
![(C13H22N6O4) Lysine theophylline;Lysine theophyllinate;L-Lysine, compd. with 3,7-dihydro-1,3-dimethyl-1H-purine-2...](https://img.guidechem.com/pic/image/83920-54-1.gif) |
Properties |
Flash Point: | 228.4°C |
Boiling Point: | 454.1°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 228.4°C |
Safety Data |
|
![](/images/detail_15.png) |