Identification |
Name: | 9,10-Anthracenedione,2,6-dihydroxy- |
Synonyms: | Anthraflavicacid (6CI);Anthraquinone, 2,6-dihydroxy- (8CI);2,6-Dihydroxy-9,10-anthracenedione;2,6-Dihydroxy-9,10-anthraquinone;2,6-Dihydroxyanthraquinone;Anthraflavin;NSC-33531; |
CAS: | 84-60-6 |
EINECS: | 201-544-3 |
Molecular Formula: | C14H8O4 |
Molecular Weight: | 240.22 |
InChI: | InChI=1/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
Molecular Structure: |
|
Properties |
Density: | 1.54 g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Refractive index: | 1.732 |
Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Skin, eye and respiratory irritant. Toxicity data (The meaning of any toxicological abbr |
Solubility: | |
Appearance: | solid |
Report: |
Reported in EPA TSCA Inventory.
|
Safety Data |
|
|