| Identification | |
| Name: | Dibutyl phthalate |
| Synonyms: | DBP; Butyl phthalate; Di-n-butyl phthalate; Phthalic acid di-n-butyl ester; Benzene-1,2-dicarboxylic acid di-n-butylester; Diisobutyl Phthalate(DIBP); Dibutyl phthalate,abbreviation; Dibutyl Phthalate(DBP); |
| CAS: | 84-74-2 |
| EINECS: | 201-557-4 |
| Molecular Formula: | C16H22O4 |
| Molecular Weight: | 278.35 |
| InChI: | InChI=1/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810/9095/3082 |
| Density: | 1.043 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.491 |
| Water Solubility: | Slightly soluble. 0.0013 g/100 mL |
| Solubility: | Slightly soluble SOLVENT |
| Appearance: | clear liquid |
| Packinggroup: | III |
| HS Code: | 29173100 |
| Color: | Colorless to faint yellow, oily liquid. |
| Usage: | Insect repellent. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
