| Identification | |
| Name: | 1,2-Benzenedicarboxylicacid, 1,2-dihexyl ester |
| Synonyms: | 1,2-Benzenedicarboxylicacid, dihexyl ester (9CI); Phthalic acid, dihexyl ester (6CI,7CI,8CI);Bis(n-hexyl) phthalate; Di-n-hexyl phthalate; Dihexyl phthalate; Jayflex DHP;NSC 4817 |
| CAS: | 84-75-3 |
| EINECS: | 201-559-5 |
| Molecular Formula: | C20H30 O4 |
| Molecular Weight: | 334.45 |
| InChI: | InChI=1/C20H30O4/c1-3-5-7-11-15-23-19(21)17-13-9-10-14-18(17)20(22)24-16-12-8-6-4-2/h9-10,13-14H,3-8,11-12,15-16H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3082 |
| Density: | 1,01 g/cm3 |
| Refractive index: | 1.493 |
| Solubility: | In water, 0.05 mg/L at 25 deg C |
| Specification: |
di-n-Hexyl phthalate (84-75-3) is an ester. Esters react with acids to liberate heat along with alcohols and acids. Strong oxidizing acids may cause a vigorous reaction that is sufficiently exothermic to ignite the reaction products. Heat is also generated by the interaction of esters with caustic solutions. Flammable hydrogen is generated by mixing esters with alkali metals and hydrides.It can react with oxidizing materials and strong alkaline materials. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Color: | Clear, oily liuid |
| Safety Data | |
 |
|
