Identification |
Name: | 1,2,4-Triazine-3,5-diamine,6-(2,3-dichlorophenyl)- |
Synonyms: | 3,5-Diamino-6-(2,3-dichlorophenyl)-1,2,4-triazine;6-(2,3-Dichlorophenyl)-1,2,4-triazine-3,5-diamine;BW 430C;LTG;Lamictal;Lamictal XR;Lamidus;Lamotrigin; |
CAS: | 84057-84-1 |
EINECS: | 281-901-8 |
Molecular Formula: | C9H7Cl2N5 |
Molecular Weight: | 256.09 |
InChI: | InChI=1/C9H7Cl2N5/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16) |
Molecular Structure: |
|
Properties |
Transport: | UN 2811 6 |
Density: | 1.572 g/cm3 |
Stability: | Stable at normal temperatures and pressures. |
Appearance: | white crystallization |
Packinggroup: | III |
Biological Activity: | Anticonvulsant. Inhibits glutamate release, possibly through inhibition of Na + , K + and Ca 2+ currents. |
Color: | white |
Usage: | An anticonvulsant. Inhibits glutamate release, possible through inhibition of Sodium, Potassium and Calcium currents |
Safety Data |
Hazard Symbols |
T: Toxic
|
|
|