| Identification | |
| Name: | 1H-Isoindole-1,3(2H)-dione,2-[(3S)-2,6-dioxo-3-piperidinyl]- |
| Synonyms: | 1H-Isoindole-1,3(2H)-dione,2-(2,6-dioxo-3-piperidinyl)-, (S)-;Phthalimide, N-(2,6-dioxo-3-piperidyl)-,L-(-)- (8CI);(-)-Thalidomide;(S)-(-)-Thalidomide;(S)-Thalidomide;NSC 91730;S-(L)-Thalidomide;Thalidomide, L-; |
| CAS: | 841-67-8 |
| EINECS: | 200-031-1 |
| Molecular Formula: | C13H10N2O4 |
| Molecular Weight: | 258.25 |
| InChI: | InChI=1/C13H10N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9H,5-6H2,(H,14,16,17)/t9-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Flash Point: | 262.1°C |
| Boiling Point: | 509.7°C at 760 mmHg |
| Density: | 1.503g/cm3 |
| Refractive index: | 1.646 |
| Solubility: | Sparingly soluble in methanol, ethanol, acetone, ethyl acetate, butyl acetate, glacial acetic acid. Very soluble in dioxane, DMF, pyridine. Practically insoluble in ether, chloroform, benzene. In water, 45-60 mg/l @ 25 deg C. |
| Appearance: | Needles |
| Flash Point: | 262.1°C |
| Color: | white |
| Usage: | Optically active isomer of Thalidomide, which inhibits FGF-induced angiogenesis. Inhibits replication of human immunodeficiency virus type 1. Teratogenic sedative |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
