| Identification |
| Name: | dodecanedioic acid, compound with 2,2'-iminodiethanol |
| Synonyms: | Dodecanedioic acid, compound with 2,2'-iminodiethanol;Dodecanedioic acid, compd. with 2,2'-iminobis(ethanol);dodecanedioic acid; 2-(2-hydroxyethylamino)ethanol |
| CAS: | 84176-56-7 |
| EINECS: | 282-322-3 |
| Molecular Formula: | C16H33NO6 |
| Molecular Weight: | 335.4363 |
| InChI: | InChI=1/C12H22O4.C4H11NO2/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16;6-3-1-5-2-4-7/h1-10H2,(H,13,14)(H,15,16);5-7H,1-4H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 305.8°C |
| Boiling Point: | 582°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 305.8°C |
| Safety Data |
| |
 |
