| Identification |
| Name: | Benzamide,N-[[(2S)-1-ethyl-2-pyrrolidinyl]methyl]-2-hydroxy-3-iodo-6-methoxy- |
| Synonyms: | Benzamide,N-[(1-ethyl-2-pyrrolidinyl)methyl]-2-hydroxy-3-iodo-6-methoxy-, (S)-;(S)-(-)-3-Iodo-2-hydroxy-6-methoxy-N-[(1-ethyl-2-pyrrolidinyl)methyl]benzamide;(S)-(-)-IBZM; IBZM |
| CAS: | 84226-06-2 |
| Molecular Formula: | C15H21 I N2 O3 |
| Molecular Weight: | 404.24331 |
| InChI: | InChI=1S/C15H21IN2O3/c1-3-18-8-4-5-10(18)9-17-15(20)13-12(21-2)7-6-11(16)14(13)19/h6-7,10,19H,3-5,8-9H2,1-2H3,(H,17,20)/t10-/m0/s1 |
| Molecular Structure: |
![(C15H21IN2O3) Benzamide,N-[(1-ethyl-2-pyrrolidinyl)methyl]-2-hydroxy-3-iodo-6-methoxy-, (S)-;(S)-(-)-3-Iodo-2-hydr...](https://img1.guidechem.com/chem/e/dict/41/84226-06-2.jpg) |
| Properties |
| Density: | 1.51 g/cm3 |
| Water Solubility: | H2O: |
| Solubility: | H2O: <0.5 mg/mL, slightly soluble |
| Appearance: | dark yellow oil |
| Storage Temperature: | 2-8°C |
| Color: | dark yellow |
| Usage: | A halogenated benzamide derivative as potential radioligands for non-invasive quantification of D2-like dopamine receptor. The main purpose of a brain study with IBZM is the differentiation of Parkinson disease from other neurodegenerative disease |
| Safety Data |
| |
 |
