| Identification | |
| Name: | Piperazine,2,2-dimethyl- |
| Synonyms: | 2,2-Dimethylpiperazine; |
| CAS: | 84477-72-5 |
| Molecular Formula: | C6H14N2 |
| Molecular Weight: | 114.19 |
| InChI: | InChI=1/C6H14N2/c1-6(2)5-7-3-4-8-6/h7-8H,3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.834 g/cm3 |
| Refractive index: | 1.417 |
| Specification: |
The systematic name about this chemical is 2,2-dimethylpiperazine. The CAS register number of 2,2-Dimethylpiperazine is 84477-72-5. It also can be called as piperazine, 2,2-dimethyl-. Physical properties about 2,2-Dimethylpiperazine are: (1)ACD/LogP: -0.58; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 2; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 0; (10)Polar Surface Area: 24.06Å2; (11)Index of Refraction: 1.417; (12)Molar Refractivity: 34.465 cm3; (13)Molar Volume: 136.935 cm3; (14)Surface Tension: 25.88 dyne/cm; (15)Density: 0.834 g/cm3; (16)Flash Point: 38.899 °C; (17)Enthalpy of Vaporization: 39.192 kJ/mol; (18)Boiling Point: 155.174 °C at 760 mmHg; (19)Vapour Pressure: 3.069 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
