| Identification | |
| Name: | 1H-Pyrazole-5-methanol,1-methyl- |
| Synonyms: | 1-Methyl-5-pyrazolemethanol;2-Methyl-2H-pyrazol-3-ylmethanol;5-(Hydroxymethyl)-1-methylpyrazole; |
| CAS: | 84547-61-5 |
| Molecular Formula: | C5H8N2O |
| Molecular Weight: | 112.12982 |
| InChI: | InChI=1/C5H8N2O/c1-7-5(4-8)2-3-6-7/h2-3,8H,4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 55-59.5 |
| Density: | 1.16 g/cm3 |
| Refractive index: | 1.552 |
| Specification: |
The CAS register number of 5-(Hydroxymethyl)-1-methyl-1H-pyrazole is 84547-61-5. It also can be called as 1H-Pyrazole-5-methanol,1-methyl- and the systematic name about this chemical is (1-methyl-1H-pyrazol-5-yl)methanol. Physical properties about 5-(Hydroxymethyl)-1-methyl-1H-pyrazole are: (1)ACD/LogP: -1.02; (2)#H bond acceptors: 3; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 2; (5)Polar Surface Area: 27.05Å2; (6)Index of Refraction: 1.552; (7)Molar Refractivity: 30.71 cm3; (8)Molar Volume: 96 cm3; (9)Polarizability: 12.17x10-24cm3; (10)Surface Tension: 42 dyne/cm; (11)Enthalpy of Vaporization: 50.78 kJ/mol; (12)Boiling Point: 243.6 °C at 760 mmHg; (13)Vapour Pressure: 0.0171 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
