| Identification | |
| Name: | Benzo(e)(1)benzothiopyrano(4,3b)-indole |
| Synonyms: | Benzo[e][1]benzothiopyrano[4,3-b]indole |
| CAS: | 846-35-5 |
| Molecular Formula: | C19H11NS |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C19H11NS/c1-2-6-13-12(5-1)9-10-16-18(13)15-11-21-17-8-4-3-7-14(17)19(15)20-16/h1-11H |
| Molecular Structure: | ![(C19H11NS) Benzo[e][1]benzothiopyrano[4,3-b]indole](https://img.guidechem.com/crawlimg/846-35-5.png) |
| Properties | |
| Flash Point: | 239.3°C |
| Boiling Point: | 472.1°C at 760 mmHg |
| Density: | 1.32g/cm3 |
| Refractive index: | 1.756 |
| Specification: |
Benzo(e)(1)benzothiopyrano(4,3b)-indole (CAS NO. 846-35-5) is a toxic substance,with flammability, burning will produce toxic fumes of nitrogen oxides and hydrogen chloride,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Flash Point: | 239.3°C |
| Safety Data | |
 |
|
