| Identification | |
| Name: | Pyrimidine,5-butyl-2-chloro- |
| Synonyms: | 5-Butyl-2-chloropyrimidine; |
| CAS: | 847227-37-6 |
| Molecular Formula: | C8H11ClN2 |
| Molecular Weight: | 170.64 |
| InChI: | InChI=1/C8H11ClN2/c1-2-3-4-7-5-10-8(9)11-6-7/h5-6H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.11 g/cm3 |
| Refractive index: | 1.512 |
| Specification: |
The CAS register number of 5-Butyl-2-chloropyrimidine is 847227-37-6. It also can be called as Pyrimidine,5-butyl-2-chloro- and the IUPAC name about this chemical is 5-butyl-2-chloropyrimidine. The molecular formula about this chemical is C8H11ClN2 and the molecular weight is 170.64. It belongs to the Pyrimidine. Physical properties about 5-Butyl-2-chloropyrimidine are: (1)ACD/LogP: 2.24; (2)ACD/LogD (pH 5.5): 2.237; (3)ACD/LogD (pH 7.4): 2.237; (4)ACD/BCF (pH 5.5): 29.522; (5)ACD/BCF (pH 7.4): 29.522; (6)ACD/KOC (pH 5.5): 392.594; (7)ACD/KOC (pH 7.4): 392.595; (8)#H bond acceptors: 2; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 25.78Å2; (11)Index of Refraction: 1.512; (12)Molar Refractivity: 46.145 cm3; (13)Molar Volume: 153.662 cm3; (14)Polarizability: 18.293x10-24cm3; (15)Surface Tension: 40.484 dyne/cm; (16)Enthalpy of Vaporization: 49.64 kJ/mol; (17)Boiling Point: 278.554 °C at 760 mmHg; (18)Vapour Pressure: 0.007 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
